BD2544648
Ethyl4-methyl-2-(trifluoromethyl)pyrimidine-5-carboxylate , 98% , 306960-67-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1103.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 54℃/0.5mm |
| Density | 1.300±0.06 g/cm3(Predicted) |
| pka | -3.00±0.29(Predicted) |
| form | solid |
| InChI | 1S/C9H9F3N2O2/c1-3-16-7(15)6-4-13-8(9(10,11)12)14-5(6)2/h4H,3H2,1-2H3 |
| InChIKey | LYEKBQSEKSEXLT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(OCC)=O)C=NC(C(F)(F)F)=N1 |
Description and Uses
Ethyl 4-Methyl-2-(trifluoromethyl)pyrimidine-5-carboxylate is used in the study of NF-κB and AP-1 gene inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H302 |
| Precautionary statements | P264-P280a-P305+P351+P338-P321-P332+P313-P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2933599590 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |




