BD2559048
(S)-2-(2,2-Dimethyl-5-oxo-1,3-dioxolan-4-yl)aceticacid , 95% , 73991-95-4
Synonym(s):
(S)-[2,2-Dimethyl-5-oxodioxolan-4-yl]acetic acid
| Pack Size | Price | Stock | Quantity |
| 1g | RMB196.00 | In Stock |
|
| 5g | RMB688.00 | In Stock |
|
| 25g | RMB2108.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 105-112 °C(lit.) |
| Boiling point: | 225.11°C (rough estimate) |
| Density | 1.2311 (rough estimate) |
| refractive index | 1.4390 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate, Methanol (Slightly) |
| pka | 3.96±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| optical activity | [α]23/D +3.7°, c = 1 in chloroform |
| InChI | InChI=1S/C7H10O5/c1-7(2)11-4(3-5(8)9)6(10)12-7/h4H,3H2,1-2H3,(H,8,9)/t4-/m0/s1 |
| InChIKey | IDQOCLIWDMZKBZ-BYPYZUCNSA-N |
| SMILES | O1C(=O)[C@H](CC(O)=O)OC1(C)C |
Description and Uses
An optically active inhibitor
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-10 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






