BD2583245
(R)-Methyl2-acetamido-3-mercaptopropanoate , 97%HPLC , 7652-46-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB156.80 | In Stock |
|
| 250mg | RMB267.20 | In Stock |
|
| 1g | RMB483.20 | In Stock |
|
| 5g | RMB1326.40 | In Stock |
|
| 25g | RMB5024.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 77-81 °C |
| Boiling point: | 326.4±32.0 °C(Predicted) |
| Density | 1.170±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Solid |
| pka | 9.13±0.10(Predicted) |
| color | White to Off-White |
| optical activity | [α]20/D 24.0±3°, c = 1% in methanol |
| BRN | 1724357 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C6H11NO3S/c1-4(8)7-5(3-11)6(9)10-2/h5,11H,3H2,1-2H3,(H,7,8)/t5-/m0/s1 |
| InChIKey | QTKAQJWFVXPIFV-YFKPBYRVSA-N |
| SMILES | C(OC)(=O)[C@H](CS)NC(C)=O |
Description and Uses
N-Acetyl-L-cysteine Methyl Ester is used in the preparation of benzyl mono-fluorophosphonate and benzyl penta-fluorophosphate anions as physiologically stable phosphotyrosine mimetics and inhibitors of protein tyrosine phosphatases. It can also be used in the preparation of anthracene derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P501-P270-P264-P301+P312+P330 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10-23 |
| Storage Class | 11 - Combustible Solids |




