BD2672448
2,4,6-Trimethoxy-1,3,5-triazine , 98% , 877-89-4
CAS NO.:877-89-4
Empirical Formula: C6H9N3O3
Molecular Weight: 171.15
MDL number: MFCD00142809
EINECS: 212-896-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB66.40 | In Stock |
|
| 25g | RMB231.20 | In Stock |
|
| 100g | RMB762.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 135-137 °C(lit.) |
| Boiling point: | 301.12°C (rough estimate) |
| Density | 1.3994 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| storage temp. | Storage temp. 2-8°C |
| pka | 1.80±0.10(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C6H9N3O3/c1-10-4-7-5(11-2)9-6(8-4)12-3/h1-3H3 |
| InChIKey | DFUGJTBMQKRCPI-UHFFFAOYSA-N |
| SMILES | N1=C(OC)N=C(OC)N=C1OC |
Description and Uses
2,4,6-Trimethoxy-1,3,5-triazine was used to investigate the molecularly imprinted solid phase extraction (MISPE) for the isolation of melamine (ML) in food products.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






