BD2680145
Sodium2-amino-5-nitrobenzenesulfonate , 98% , 30693-53-9
CAS NO.：30693-53-9
Empirical Formula: C6H5N2O5S.Na
Molecular Weight: 240.17
MDL number: MFCD00797933
EINECS: 250-299-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB36.00 | In Stock |
|
| 5g | RMB68.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150-152°C |
| Boiling point: | 418.94℃ |
| Density | 0.737g/cm3 at 21℃ |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Solid |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C6H6N2O5S.Na/c7-5-2-1-4(8(9)10)3-6(5)14(11,12)13;/h1-3H,7H2,(H,11,12,13);/q;+1/p-1 |
| InChIKey | VTMRGLXTSDVXAE-UHFFFAOYSA-M |
| SMILES | C1(S([O-])(=O)=O)=C(N)C=CC([N+]([O-])=O)=C1.[Na+] |
| Dissociation constant | 0 at 21℃ |
| CAS DataBase Reference | 30693-53-9(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenesulfonic acid, 2-amino-5-nitro-, monosodium salt (30693-53-9) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
