BD2714445
4-Chloro-2,8-bis-trifluoromethylquinoline , 97% , 83012-13-9
CAS NO.:83012-13-9
Empirical Formula: C11H4ClF6N
Molecular Weight: 299.6
MDL number: MFCD00075104
EINECS: 280-132-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB114.40 | In Stock |
|
| 1g | RMB253.60 | In Stock |
|
| 5g | RMB1000.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 46-48 °C (lit.) |
| Boiling point: | 148-152 °C(Press: 18 Torr) |
| Density | 1.5242 (estimate) |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | -3.49±0.50(Predicted) |
| form | Crystalline Powder |
| color | Beige |
| InChI | 1S/C11H4ClF6N/c12-7-4-8(11(16,17)18)19-9-5(7)2-1-3-6(9)10(13,14)15/h1-4H |
| InChIKey | ZSQOESPYYNJBCZ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(Cl)c2cccc(c2n1)C(F)(F)F |
| CAS DataBase Reference | 83012-13-9(CAS DataBase Reference) |
Description and Uses
4-Chloro-2,8-bis(trifluoromethyl)quinolone is the intermediate formed during the synthesis of quinoline derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29334900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






