BD2736945
6-Nitro-4-oxo-4H-chromene-3-carbaldehyde , 94% , 42059-80-3
Synonym(s):
6-Nitro-4-oxo-4H-1-benzopyran-3-carboxaldehyde
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB56.00 | In Stock |
|
| 1g | RMB112.00 | In Stock |
|
| 5g | RMB464.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 157-161 °C (lit.) |
| Boiling point: | 406.2±45.0 °C(Predicted) |
| Density | 1.641±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| InChI | 1S/C10H5NO5/c12-4-6-5-16-9-2-1-7(11(14)15)3-8(9)10(6)13/h1-5H |
| InChIKey | JBDRQGWTNRIJRV-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc2OC=C(C=O)C(=O)c2c1 |
Description and Uses
3-Formyl-6-nitrochromone is the suitable reagent used in a study to investigate the multidrug resistance reversal by some 3- formylchromones in human colon cancer and mouse lymphoma cells transfected with the human MDR1 gene. It is the suitable reagent used in the synthesis of uridine-based library.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
