BD2782045
(11bS)-4-Hydroxy-2,6-bis(2,4,6-triisopropylphenyl)dinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine4-oxide , 98%+99%ee , 874948-63-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB137.60 | In Stock |
|
| 250mg | RMB312.00 | In Stock |
|
| 1g | RMB1009.60 | In Stock |
|
| 5g | RMB4380.00 | In Stock |
|
| 10g | RMB8478.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 814.2±75.0 °C(Predicted) |
| Density | 1.17±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 1.12±0.20(Predicted) |
| form | Powder |
| color | white to light-yellow |
| InChIKey | AGQAQYPGJDBIQR-UHFFFAOYSA-N |
| SMILES | C1C=C2C=C(C3=C(C(C)C)C=C(C(C)C)C=C3C(C)C)C3OP(O)(=O)OC4=C(C5C(C(C)C)=CC(C(C)C)=CC=5C(C)C)C=C5C=CC=CC5=C4C=3C2=CC=1 |
Description and Uses
Versatile organocatalyst. Uses include asymmetric reductive amination, enantioselective Diels-Alder reactions and asymmetric counteranion-directed catalysis (ACDC). Can be used in cooperation with chiral iridium complexes to catalyze greener asymmetric reductive amination using hydrogen gas.
Metal-Brnsted Acid Cooperative Catalysis for Asymmetric Reductive Amination
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P271 |
| WGK Germany | 3 |
| HS Code | 29199000 |

![(11bS)-4-Hydroxy-2,6-bis(2,4,6-triisopropylphenyl)dinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine4-oxide](https://img.chemicalbook.com/CAS/GIF/874948-63-7.gif)


![(11bS)-4-Hydroxy-2,6-bis(2,4,6-trimethylphenyl)-4-oxide-dinaphtho[2,1-d:1'',2''-f][1,3,2]dioxaphosphepin](https://img.chemicalbook.com/CAS/20210111/GIF/878111-18-3.gif)

