BD2830448
Naphthalene-2,3-dicarbonitrile , 98% , 22856-30-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB109.60 | In Stock |
|
| 1g | RMB280.00 | In Stock |
|
| 5g | RMB1012.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 253-257 °C |
| Boiling point: | 300.41°C (rough estimate) |
| Density | 1.2218 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | slightly sol. in Chloroform |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 2574929 |
| InChI | InChI=1S/C12H6N2/c13-7-11-5-9-3-1-2-4-10(9)6-12(11)8-14/h1-6H |
| InChIKey | KNBYJRSSFXTESR-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC(C#N)=C1C#N |
| CAS DataBase Reference | 22856-30-0(CAS DataBase Reference) |
Description and Uses
2,3-Naphthalenedicarbonitrile is a precursor to a molecular semiconductor. Dyes and metabolites.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 36/37-37/39-26 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2926907090 |




