BD2846945
TTNPB , 98% , 71441-28-6
Synonym(s):
4-[(E)-2-(5,6,7,8-Tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)-1-propenyl]benzoic acid;Arotinoid acid;TTNPB - CAS 71441-28-6 - Calbiochem
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB536.80 | In Stock |
|
| 100mg | RMB812.80 | In Stock |
|
| 250mg | RMB1219.20 | In Stock |
|
| 1g | RMB3048.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 242 °C |
| Boiling point: | 422.83°C (rough estimate) |
| Density | 1.0932 (rough estimate) |
| refractive index | 1.4480 (estimate) |
| storage temp. | -20°C |
| solubility | chloroform/methanol: soluble9.80 - 10.20 mg/mL, clear, colorless to light yellow |
| form | White solid |
| pka | 4.28±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C24H28O2/c1-16(14-17-6-8-18(9-7-17)22(25)26)19-10-11-20-21(15-19)24(4,5)13-12-23(20,2)3/h6-11,14-15H,12-13H2,1-5H3,(H,25,26)/b16-14+ |
| InChIKey | FOIVPCKZDPCJJY-JQIJEIRASA-N |
| SMILES | C(O)(=O)C1=CC=C(/C=C(/C2=CC=C3C(=C2)C(C)(C)CCC3(C)C)\C)C=C1 |
| CAS DataBase Reference | 71441-28-6 |
Description and Uses
TTNPB is an analog of retinoic acid that potently and selectively activates retinoic acid receptors.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H315-H319-H335-H360 |
| Precautionary statements | P202-P261-P264-P302+P352-P305+P351+P338-P308+P313 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 60-61-36/37/38 |
| Safety Statements | 53-26-36/37/39-45 |
| WGK Germany | 3 |
| RTECS | DH6834900 |
| HS Code | 2916.39.7900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT SE 3 |








