LN7207752
EC23 , 98% , 104561-41-3
Synonym(s):
4-((5,5,8,8-Tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethynyl)benzoic acid;4-[2-(5,6,7,8-Tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)ethynyl]benzoic acid;EC 23;EC-23
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1917.60 | In Stock |
|
| 1mL*10mM(inDMSO) | RMB1997.60 | In Stock |
|
| 10mg | RMB3189.60 | In Stock |
|
| 25mg | RMB5741.60 | In Stock |
|
| 50mg | RMB8612.80 | In Stock |
|
| 100mg | RMB12919.20 | In Stock |
|
| 200mg | RMB19379.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 254-256 °C(Solv: acetonitrile (75-05-8)) |
| Boiling point: | 484.7±45.0 °C(Predicted) |
| Density | 1.15±0.1 g/cm3(Predicted) |
| storage temp. | Store at +4°C |
| solubility | DMF: 5 mg/ml; DMSO: 5 mg/ml; DMSO:PBS (pH 7.2) (1:1): 0.5 mg/ml; Ethanol: 1 mg/ml |
| pka | 4.10±0.10(Predicted) |
| form | White to off-white lyophilised amorphous solid. |
| color | Off-white to light yellow |
| InChI | 1S/C23H24O2/c1-22(2)13-14-23(3,4)20-15-17(9-12-19(20)22)6-5-16-7-10-18(11-8-16)21(24)25/h7-12,15H,13-14H2,1-4H3,(H,24,25) |
| InChIKey | OQVLOWLEEHYBJH-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc(cc1)C#Cc2cc3c(cc2)C(CCC3(C)C)(C)C |
Description and Uses
EC 23 is an ATRA analog with similar activity. EC 23 potently induces neural differentiation in human pluripotent embryonic stem cells.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H361d |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Repr. 2 |






