BD2850845
2-Vinylphenylacetate , 93%(stabilizedwithPhenothiazine) , 63600-35-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB169.60 | In Stock |
|
| 250mg | RMB288.00 | In Stock |
|
| 1g | RMB776.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 55-57 °C(Press: 0.4 Torr) |
| Density | 1.07 |
| refractive index | 1.5350-1.5390 |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C10H10O2/c1-3-9-6-4-5-7-10(9)12-8(2)11/h3-7H,1H2,2H3 |
| InChIKey | WRPYDXWBHXAKPT-UHFFFAOYSA-N |
| SMILES | C1(OC(=O)C)=CC=CC=C1C=C |
| CAS DataBase Reference | 63600-35-1 |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 2916399090 |
