BD2869548
1,2-Dibromocyclopent-1-ene , 96% , 75415-78-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB176.00 | In Stock |
|
| 1g | RMB475.20 | In Stock |
|
| 5g | RMB1661.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 78 °C/5 mmHg (lit.) |
| Density | 1.895 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | liquid |
| color | Clear, orange |
| InChI | InChI=1S/C5H6Br2/c6-4-2-1-3-5(4)7/h1-3H2 |
| InChIKey | PNWFXPGGROADNS-UHFFFAOYSA-N |
| SMILES | C1(Br)CCCC=1Br |
| CAS DataBase Reference | 75415-78-0(CAS DataBase Reference) |
Description and Uses
1,2-Dibromocyclopentene has been used in the synthesis of cyclopentene analogs.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312-H315-H319-H335 |
| Precautionary statements | P280 |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| HS Code | 29035980 |
