BD2880545
3-(4-Fluorobenzoyl)-1,1,1-trifluoroacetone , 95% , 582-65-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB125.60 | In Stock |
|
| 1g | RMB316.80 | In Stock |
|
| 5g | RMB1078.40 | In Stock |
|
| 10g | RMB2071.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 40-42°C |
| Boiling point: | 257.0±35.0 °C(Predicted) |
| Density | 1.363±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Solid |
| pka | 5.61±0.25(Predicted) |
| color | White |
| InChI | 1S/C10H6F4O2/c11-7-3-1-6(2-4-7)8(15)5-9(16)10(12,13)14/h1-4H,5H2 |
| InChIKey | KEZLARPKXOHKJS-UHFFFAOYSA-N |
| SMILES | O=C(CC(C(C=C1)=CC=C1F)=O)C(F)(F)F |
| CAS DataBase Reference | 582-65-0 |
Description and Uses
4,4,4-Trifluoro-1-(4-fluorophenyl)butane-1,3-dioneis an intermediate in the synthesis of Mavacoxib (M197900) which is a long-acting COX-2 Inhibitor and is developed as a veterinary drug used to treat pain and inflammation with degenerative joint disease for dogs.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2914790090 |
| Storage Class | 11 - Combustible Solids |
