BD2888248
5,7-Dichloro-1H-indole , 98% , 4792-72-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB129.60 | In Stock |
|
| 250mg | RMB266.40 | In Stock |
|
| 1g | RMB737.60 | In Stock |
|
| 5g | RMB2473.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55 °C |
| Boiling point: | 85-90 °C(Press: 0.1 Torr) |
| Density | 1.479±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 14.51±0.30(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C8H5Cl2N/c9-6-3-5-1-2-11-8(5)7(10)4-6/h1-4,11H |
| InChIKey | RKGKZFMRYKCMEJ-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Cl)C=C2Cl)C=C1 |
Description and Uses
5,7-Dichloroindole is used in the synthesis of various complex pharmacological compounds. Its presence in the indole ring structure allows for the creation of a wide range of biologically active molecules, making it a valuable asset in drug development.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
