BD2895745
(S)-3-((tert-Butoxycarbonyl)amino)-4-(4-cyanophenyl)butanoicacid , 98% , 270065-89-9
Synonym(s):
(S)-3-(Boc-amino)-4-(4-cyanophenyl)butyric acid;Boc-4-cyano-L -β-homophenylalanine
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB288.80 | In Stock |
|
| 250mg | RMB432.00 | In Stock |
|
| 1g | RMB1080.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.19 |
| storage temp. | 2-8°C |
| form | powder |
| Appearance | White to off-white Solid |
| Major Application | peptide synthesis |
| InChI | 1S/C16H20N2O4/c1-16(2,3)22-15(21)18-13(9-14(19)20)8-11-4-6-12(10-17)7-5-11/h4-7,13H,8-9H2,1-3H3,(H,18,21)(H,19,20)/t13-/m0/s1 |
| InChIKey | UXSGGQWSQPYJTQ-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(O)=O)Cc1ccc(cc1)C#N |
| CAS DataBase Reference | 270065-89-9(CAS DataBase Reference) |
Description and Uses
Boc-(S)-3-amino-4-(4-cyanophenyl)butanoic Acid has been used as a reactant for the preparation of GSK 923295 as inhibitor of centromere-associated protein E.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H332 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P330-P363-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
