![(3aR,6aS)-3,3a,6,6a-Tetrahydro-2H-cyclopenta[b]furan-2-one](https://img.chemicalbook.com/CAS/GIF/43119-28-4.gif)
BD2901648
(3aR,6aS)-3,3a,6,6a-Tetrahydro-2H-cyclopenta[b]furan-2-one , 95% , 43119-28-4
Synonym(s):
(3aR,6aS)-3,3a,6,6a-Tetrahydro-2H-1-oxapentalen-2-one;(3aR,6aS)-3,3a,6,6a-Tetrahydro-2H-cyclopenta[b]furan-2-one
CAS NO.：43119-28-4
Empirical Formula: C7H8O2
Molecular Weight: 124.14
MDL number: MFCD00010402
EINECS: 610-106-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB177.60 | In Stock |
|
| 250mg | RMB296.00 | In Stock |
|
| 1g | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 44-46 °C(lit.) |
| Boiling point: | 263.1℃ |
| Density | 1.196 |
| refractive index | 1.4906 (estimate) |
| Flash point: | 104.0℃ |
| storage temp. | 2-8°C |
| solubility | DMF: 30 mg/ml,DMSO: 30 mg/ml,DMSO:PBS (pH 7.2) (1:2): 0.33 mg/ml,Ethanol: 15 mg/ml |
| form | A crystalline solid |
| color | Off-white to light yellow |
| optical activity | [α]22/D 103°, c = 1 in methanol |
| BRN | 3537516 |
| InChI | InChI=1S/C7H8O2/c8-7-4-5-2-1-3-6(5)9-7/h1-2,5-6H,3-4H2/t5-,6-/m0/s1 |
| InChIKey | RYBPGUMSFWGGLP-WDSKDSINSA-N |
| SMILES | O1C(=O)C[C@]2([H])C=CC[C@]12[H] |
Description and Uses
(?)-G-Lactone is a synthetic intermediate useful for prostaglandins synthesis[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| WGK Germany | 3 |
| F | 10-21 |
