BD2911948
4-((Trimethylsilyl)ethynyl)aniline , 98% , 75867-39-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB140.80 | In Stock |
|
| 1g | RMB284.00 | In Stock |
|
| 5g | RMB1004.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94-98℃ |
| Boiling point: | 258.9±32.0 °C(Predicted) |
| Density | 0.97±0.1 g/cm3(Predicted) |
| Flash point: | >110°C |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 5.13±0.10(Predicted) |
| color | White to Brown |
| InChI | InChI=1S/C11H15NSi/c1-13(2,3)9-8-10-4-6-11(12)7-5-10/h4-7H,12H2,1-3H3 |
| InChIKey | CHTZIDLXGXGNMA-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(C#C[Si](C)(C)C)C=C1 |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H413 |
| Precautionary statements | P273-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



