BD2954148
5,8-Dihydroxynaphthalene-1,4-dione , 98% , 475-38-7
Synonym(s):
Naphthazarin
CAS NO.:475-38-7
Empirical Formula: C10H6O4
Molecular Weight: 190.15
MDL number: MFCD00001685
EINECS: 207-495-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB249.60 | In Stock |
|
| 250mg | RMB424.00 | In Stock |
|
| 1g | RMB1143.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220-230 °C(lit.) |
| Boiling point: | 285.64°C (rough estimate) |
| Density | 1.3366 (rough estimate) |
| refractive index | 1.5280 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 6.98±0.20(Predicted) |
| form | powder to crystaline |
| color | Dark red to Brown |
| Water Solubility | Soluble in water (5520 mg/L 25.). |
| BRN | 880561 |
| Cosmetics Ingredients Functions | COLORANT HAIR CONDITIONING |
| InChI | InChI=1S/C10H6O4/c11-5-1-2-6(12)10-8(14)4-3-7(13)9(5)10/h1-4,11-12H |
| InChIKey | RQNVIKXOOKXAJQ-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C(O)=CC=C2O)C(=O)C=C1 |
| CAS DataBase Reference | 475-38-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,4-Naphthalenedione, 5,8-dihydroxy-(475-38-7) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P305+P351+P338-P405-P501a-P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26 |
| WGK Germany | 3 |
| RTECS | QL7970000 |
| HS Code | 2914409000 |




