BD2978445
(R)-3-Amino-4-(2,4,5-trifluorophenyl)butanoicacid , 95% , 936630-57-8
CAS NO.:936630-57-8
Empirical Formula: C10H10F3NO2
Molecular Weight: 233.19
MDL number: MFCD07363507
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB108.80 | In Stock |
|
| 1g | RMB276.00 | In Stock |
|
| 5g | RMB831.20 | In Stock |
|
| 10g | RMB1430.40 | In Stock |
|
| 25g | RMB2860.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 217-219 °C(Solv: water (7732-18-5); acetone (67-64-1)) |
| Boiling point: | 326.6±42.0 °C(Predicted) |
| Density | 1.399 |
| storage temp. | 2-8°C(protect from light) |
| pka | 3.66±0.10(Predicted) |
| Appearance | White to off-white Solid |
| Major Application | pharmaceutical small molecule |
| InChI | InChI=1/C10H10F3NO2/c11-7-4-9(13)8(12)2-5(7)1-6(14)3-10(15)16/h2,4,6H,1,3,14H2,(H,15,16)/t6-/s3 |
| InChIKey | KEFQQJVYCWLKPL-ISZMHOAENA-N |
| SMILES | C1(F)C(F)=CC(F)=C(C[C@@H](N)CC(O)=O)C=1 |&1:9,r| |
Description and Uses
pharmaceutical small molecule
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| WGK Germany | WGK 3 |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







