BD2978745
4'-Methoxy-[1,1'-biphenyl]-4-carbaldehyde , 96% , 52988-34-8
Synonym(s):
4′-Methoxybiphenyl-4-carboxaldehyde
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB89.60 | In Stock |
|
| 1g | RMB216.00 | In Stock |
|
| 5g | RMB750.40 | In Stock |
|
| 25g | RMB2624.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-100°C |
| Flash point: | >110°(230°F) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | solid |
| Appearance | White to off-white Solid |
| Sensitive | Air Sensitive |
| InChI | 1S/C14H12O2/c1-16-14-8-6-13(7-9-14)12-4-2-11(10-15)3-5-12/h2-10H,1H3 |
| InChIKey | JTTIGLYPLMYHAT-UHFFFAOYSA-N |
| SMILES | COc1ccc(cc1)-c2ccc(C=O)cc2 |
| CAS DataBase Reference | 52988-34-8(CAS DataBase Reference) |
Description and Uses
4''-Methoxybiphenyl-4-carboxaldehyde acts as a reagent in the research studies involving the use of aryliden-methyloxazolones as reversible MAGL inhibitors for cancer treatment.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2912490090 |
| Storage Class | 13 - Non Combustible Solids |

![4'-Methoxy-[1,1'-biphenyl]-4-carbaldehyde](https://img.chemicalbook.com/CAS/GIF/52988-34-8.gif)




