BD3026957
4-(N-nitrosomethylamino)-1-(3-pyridyl)-1-butanone , 98% , 64091-91-4
Synonym(s):
4-(Methylnitrosamino)-1-(3-pyridinyl)-1-butanone;4-(Methylnitrosoamino)-1-(3-pyridinyl)-1-butanone;NNK
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB225.60 | In Stock |
|
| 250mg | RMB383.20 | In Stock |
|
| 1g | RMB1033.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 63-65°C |
| Boiling point: | 346.25°C (rough estimate) |
| Density | 1.1933 (rough estimate) |
| refractive index | 1.4830 (estimate) |
| Flash point: | 9℃ |
| storage temp. | Amber Vial, -20°C Freezer |
| solubility | DMF: 30 mg/ml, DMSO: 25 mg/ml, Ethanol: 25 mg/ml, |
| pka | 3.19±0.10(Predicted) |
| form | Solid |
| color | White to light yellow |
| BRN | 3548355 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | InChI=1S/C10H13N3O2/c1-13(12-15)7-3-5-10(14)9-4-2-6-11-8-9/h2,4,6,8H,3,5,7H2,1H3 |
| InChIKey | FLAQQSHRLBFIEZ-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CN=C1)(=O)CCCN(C)N=O |
| CAS DataBase Reference | 64091-91-4 |
| IARC | 1 (Vol. Sup 7, 89, 100E) 2012 |
| EPA Substance Registry System | 4-(Nitrosomethylamino)-1-(3-pyridyl)-1-butanone (64091-91-4) |
Description and Uses
This compound was present in the highest concentrations in smokeless tobacco out of the nitrosamines identified. Readily produces cancer in rats and hamsters
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H317-H351 |
| Precautionary statements | P201-P280-P301+P310+P330-P302+P352 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn,T,F |
| Risk Statements | 26/27/28-45-43-40-22-39/23/24/25-23/24/25-11 |
| Safety Statements | 45-53-36/37-16 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | OB6465000 |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 38220090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Carc. 2 Skin Sens. 1 |
| Hazardous Substances Data | 64091-91-4(Hazardous Substances Data) |
| Toxicity | LD50 intraperitoneal in mouse: 1gm/kg |




