![1,4-Bis[[(8α,9R)-10,11-dihydro-6′-methoxycinchonan-9-yl]oxy]-9,10-anthracenedione](https://img.chemicalbook.com/CAS/GIF/176097-24-8.gif)
BD3040945
1,4-Bis[[(8α,9R)-10,11-dihydro-6′-methoxycinchonan-9-yl]oxy]-9,10-anthracenedione , 96% , 176097-24-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB303.20 | In Stock |
|
| 250mg | RMB454.40 | In Stock |
|
| 1g | RMB1382.40 | In Stock |
|
| 5g | RMB6630.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~160 °C (dec.) |
| Density | 1.33±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 9.81±0.70(Predicted) |
| form | solid |
| Appearance | Light yellow to green yellow Solid |
| optical activity | [α]20/D +495°, c = 1 in chloroform |
| InChIKey | ARCFYUDCVYJQRN-KGHNJIHGSA-N |
| SMILES | CC[C@@H]1CN2CC[C@H]1C[C@@H]2[C@H](Oc3ccc(O[C@@H]([C@H]4C[C@@H]5CCN4C[C@H]5CC)c6ccnc7ccc(OC)cc67)c8C(=O)c9ccccc9C(=O)c38)c%10ccnc%11ccc(OC)cc%10%11 |
Description and Uses
Superior ligand for asymmetric dihydroxylation reactions of most olefins bearing aliphatic substituents or olefins having heteroatoms in the allylic position.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
