BD3041245
3-Methylisoxazole-5-aceticAcid , 98% , 19668-85-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB41.60 | In Stock |
|
| 1g | RMB128.80 | In Stock |
|
| 5g | RMB548.00 | In Stock |
|
| 25g | RMB2180.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 101-104 °C (lit.) |
| Boiling point: | 306.7±27.0 °C(Predicted) |
| Density | 1.292±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | Fine Crystalline Powder or Needle-Like Crystals |
| pka | 3.70±0.10(Predicted) |
| color | White, darkens on exposure to light |
| InChI | InChI=1S/C6H7NO3/c1-4-2-5(10-7-4)3-6(8)9/h2H,3H2,1H3,(H,8,9) |
| InChIKey | POEFJFLAFQWOTL-UHFFFAOYSA-N |
| SMILES | O1C(CC(O)=O)=CC(C)=N1 |
Description and Uses
3-Methyl-5-isoxazoleacetic acid may be used as a reagent in the solid phase synthesis of von Hippel-Lindau protein (VHL) ligands. It may also be used to prepare (N-(4-chlorophenyl)-α-[[(4-chlorophenyl)amino]methylene]-3-methyl-5-isoxazoleacetamide).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
