BD3048245
PalmiticacidN-hydroxysuccinimideester , 98% , 14464-31-4
Synonym(s):
N-(Palmitoyloxy)succinimide;N-Succinimidyl palmitate;Palmitic acid N-succinimidyl ester
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB59.20 | In Stock |
|
| 1g | RMB128.00 | In Stock |
|
| 5g | RMB576.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 81°C |
| Boiling point: | 447.1±28.0 °C(Predicted) |
| Density | 1.03±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| BRN | 1547411 |
| Stability: | Moisture Sensitive; Store in Freezer |
| InChI | InChI=1S/C20H35NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20(24)25-21-18(22)16-17-19(21)23/h2-17H2,1H3 |
| InChIKey | OTNHQVHEZCBZQU-UHFFFAOYSA-N |
| SMILES | C(ON1C(=O)CCC1=O)(=O)CCCCCCCCCCCCCCC |
Description and Uses
N-Succinimidyl palmitate is an intermidate for synthesis of lipid molecules. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules.
N-hydroxysuccinimide ester of palmitic acid. Esters of N-hydroxysuccinimide have been used for the preparation of N-acylamino acids, aminoacyl-tRNA, coenzyme A, thioglycolic acid, ceramides, etc.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 10 |
| Storage Class | 11 - Combustible Solids |





