BD3049757
DDAO , 99% , 118290-05-4
CAS NO.:118290-05-4
Empirical Formula: C15H11Cl2NO2
Molecular Weight: 308.16
MDL number: MFCD01311087
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB688.00 | In Stock |
|
| 50mg | RMB1160.00 | In Stock |
|
| 100mg | RMB1972.00 | In Stock |
|
| 250mg | RMB3600.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 449℃ |
| Density | 1.46 |
| Flash point: | 225℃ |
| pka | 9.97±0.60(Predicted) |
| form | Solid |
| color | Purple to purplish red |
| InChI | InChI=1S/C15H11Cl2NO2/c1-15(2)8-5-7(19)3-4-10(8)18-11-6-9(16)14(20)13(17)12(11)15/h3-6,19H,1-2H3 |
| InChIKey | IIBCJNSFAIYYJJ-UHFFFAOYSA-N |
| SMILES | C1(Cl)=C2C(=NC3=C(C2(C)C)C=C(O)C=C3)C=C(Cl)C1=O |
Description and Uses
DDAO is a far-red fluorogenic substrate for esterase and lipase.
DDAO is the derivative of 2,6-Dichloroquinone-4-chloroimide (D195160), which is used as a reagent for the spectrophotometric determination of phenols as well as other aromatic compounds.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |




