BD3051245
D-Glucaricacid , 97% , 87-73-0
CAS NO.:87-73-0
Empirical Formula: C6H10O8
Molecular Weight: 210.14
MDL number: MFCD00043409
EINECS: 201-768-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB134.40 | In Stock |
|
| 250mg | RMB228.00 | In Stock |
|
| 1g | RMB615.20 | In Stock |
|
| 5g | RMB2152.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125-126° |
| Boiling point: | 269.65°C (rough estimate) |
| alpha | D19 +6.86° +20.60° (H2O) |
| Density | 1.5274 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Easily soluble (water, ethanol) |
| form | Solid |
| pka | 2.99±0.35(Predicted) |
| color | White to off-white |
| optical activity | +7 → +21 |
| Cosmetics Ingredients Functions | HAIR CONDITIONING |
| InChI | InChI=1S/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/t1-,2-,3-,4+/m0/s1 |
| InChIKey | DSLZVSRJTYRBFB-LLEIAEIESA-N |
| SMILES | C(O)(=O)[C@@H]([C@H]([C@@H]([C@@H](C(O)=O)O)O)O)O |
Description and Uses
Saccharic acid, also called glucaric acid, is a chemical compound with the formulaC6H10O8. It is derived by oxidizing a sugar such as glucose with nitric acid.
The salts of saccharic acid are called saccharates.
Pharmaceutic aid (stabilizer).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H227 |
| Precautionary statements | P501-P210-P264-P280-P302+P352-P370+P378-P337+P313-P305+P351+P338-P362+P364-P332+P313-P403+P235 |
| WGK Germany | 3 |



