ProcyanidinB1 , 98% , 20315-25-7
Synonym(s):
(−)-Epicatechin (4β-8)-(+)-catechin;cis,trans′′-4,8′′-Bi-(3,3′,4′,5,7-Pentahydroxyflavane);Proanthocyanidin B1
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB632.00 | In Stock |
|
| 10mg | RMB1074.40 | In Stock |
|
| 25mg | RMB1825.60 | In Stock |
|
| 50mg | RMB3102.40 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 231~232℃ |
| Boiling point: | 955.3±65.0 °C(Predicted) |
| Density | 1.705±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Acetone (Slightly), Ethanol (Slightly), Methanol (Slightly), Water (Slightly) |
| pka | 9.29±0.60(Predicted) |
| form | Solid |
| color | Pale Brown |
| InChIKey | XFZJEEAOWLFHDH-UKWJTHFESA-N |
| SMILES | [C@H]1(C2=CC=C(O)C(O)=C2)OC2=CC(O)=CC(O)=C2[C@H](C2=C3O[C@H](C4=CC=C(O)C(O)=C4)[C@@H](O)CC3=C(O)C=C2O)[C@H]1O |
| LogP | 0.300 (est) |
Description and Uses
Procyanidin B1 is a polyphenol flavonoid existing as a dimer of (+)-catechin and (−)-epicatechin . It inhibits hepatitis C virus RNA replication (EC50 = 72 μM), while (+)-catechin and (−)-epicatechin do not, up to concentrations of 200 μM. Procyanidin B1 (10 μg/ml) prevents phosphorylation of ERK1/2 and the production of reactive oxygen species (ROS) in THP-1 cells. It decreases TNF-α, phosphorylated p38 MAPK, and NF-κB levels following LPS administration.
Procyanidins B1 is a B type proanthocyanidins found in ceylon cinnamon and is known to exhibit anti-inflammatory effects.





