A6831012
                    ProcyanidinB2 , Analysis standard , 29106-49-8
                            Synonym(s):
(−)-Epicatechin (4β-8)-(−)-epicatechin;cis,cis″-4,8″-Bi(3,3′,4′,5,7-pentahydroxyflavane);4,8″-Bi-[(+)-epicatechin];Proanthocyanidin B2
                            
                        
                | Pack Size | Price | Stock | Quantity | 
| 1MG | RMB487.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 197-198℃ | 
                                    
| Boiling point: | 955.3±65.0 °C(Predicted) | 
                                    
| Density | 1.705 | 
                                    
| storage temp. | Inert atmosphere,2-8°C | 
                                    
| solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) | 
                                    
| pka | 9.29±0.60(Predicted) | 
                                    
| form | Solid | 
                                    
| color | Light Red to Brown | 
                                    
| Stability: | Hygroscopic | 
                                    
| InChIKey | XFZJEEAOWLFHDH-NFJBMHMQSA-N | 
                                    
| SMILES | [C@H]1(C2=CC=C(O)C(O)=C2)OC2=CC(O)=CC(O)=C2[C@H](C2=C3O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)CC3=C(O)C=C2O)[C@H]1O | 
                                    
| LogP | 0.300 (est) | 
                                    
Description and Uses
Procyanidin B2 is a selective protein kinase C inhibitor and was also found to promote hair epithelial cell growth and stimulate anagen induction. Procyanidin B2 extracted from apples have also shown anti-inflammatory activities.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302-H315-H319-H335 | 
| Precautionary statements | P261-P305+P351+P338 | 
| Safety Statements | 22-24/25 | 
| WGK Germany | 3 | 







