A6831012
ProcyanidinB2 , Analysis standard , 29106-49-8
Synonym(s):
(−)-Epicatechin (4β-8)-(−)-epicatechin;cis,cis″-4,8″-Bi(3,3′,4′,5,7-pentahydroxyflavane);4,8″-Bi-[(+)-epicatechin];Proanthocyanidin B2
| Pack Size | Price | Stock | Quantity |
| 1MG | RMB487.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 197-198℃ |
| Boiling point: | 955.3±65.0 °C(Predicted) |
| Density | 1.705 |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| pka | 9.29±0.60(Predicted) |
| form | Solid |
| color | Light Red to Brown |
| Stability: | Hygroscopic |
| InChIKey | XFZJEEAOWLFHDH-NFJBMHMQSA-N |
| SMILES | [C@H]1(C2=CC=C(O)C(O)=C2)OC2=CC(O)=CC(O)=C2[C@H](C2=C3O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)CC3=C(O)C=C2O)[C@H]1O |
| LogP | 0.300 (est) |
Description and Uses
Procyanidin B2 is a selective protein kinase C inhibitor and was also found to promote hair epithelial cell growth and stimulate anagen induction. Procyanidin B2 extracted from apples have also shown anti-inflammatory activities.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |







