BD6045248
ProcyanidinB3 , 98+% , 23567-23-9
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB543.20 | In Stock |
|
| 5mg | RMB1357.60 | In Stock |
|
| 10mg | RMB2307.20 | In Stock |
|
| 25mg | RMB3922.40 | In Stock |
|
| 50mg | RMB6668.00 | In Stock |
|
| 100mg | RMB11336.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 218-219℃ |
| Boiling point: | 955.3±65.0 °C(Predicted) |
| Density | 1.705 |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in acetone and acetonitrile |
| form | powder |
| pka | 9.29±0.60(Predicted) |
| color | White |
| InChIKey | XFZJEEAOWLFHDH-AVFWISQGSA-N |
| SMILES | [C@H]1(C2=CC=C(O)C(O)=C2)OC2=CC(O)=CC(O)=C2[C@@H](C2=C3O[C@H](C4=CC=C(O)C(O)=C4)[C@@H](O)CC3=C(O)C=C2O)[C@@H]1O |
| CAS DataBase Reference | 23567-23-9 |
Description and Uses
Procyanidin B3 is a natural product that acts as a specific HAT inhibitor. Procyanidin B3 is a polyphenol flavonoid dimer of (+)-catechin with diverse biological properties. Procyanidin B3 is a dimeric flavanol and an antifungal phenol extracted from Woodfordia uniflora.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






