BD3068545
Morusin , 95% , 62596-29-6
CAS NO.：62596-29-6
Empirical Formula: C25H24O6
Molecular Weight: 420.45
MDL number:
EINECS: 300-006-7
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB680.00 | In Stock |
|
| 25mg | RMB1156.00 | In Stock |
|
| 50mg | RMB1733.60 | In Stock |
|
| 100mg | RMB2600.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 232-235℃ |
| Boiling point: | 656.7±55.0 °C(Predicted) |
| Density | 1.303 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMF: 20mg/mL; DMF:PBS (pH 7.2) (1:3): 0.25mg/mL; DMSO: 10mg/mL; Ethanol: 15mg/mL |
| form | powder |
| pka | 6.55±0.60(Predicted) |
| color | Beige-orange |
| Stability: | Light Sensitive |
| Major Application | food and beverages |
| InChI | 1S/C25H24O6/c1-13(2)5-7-17-22(29)21-19(28)12-20-16(9-10-25(3,4)31-20)24(21)30-23(17)15-8-6-14(26)11-18(15)27/h5-6,8-12,26-28H,7H2,1-4H3 |
| InChIKey | XFFOMNJIDRDDLQ-UHFFFAOYSA-N |
| SMILES | [o]1c2c([c](c(c1c4c(cc(cc4)O)O)CC=C(C)C)=O)c(cc3c2C=CC(O3)(C)C)O |
Description and Uses
Morusin is an inhibitor of human cervical cancer stem cell growth, attenuating NF-kB activity, and initiating apoptosis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
