A6959258
Diacerein , 10mMinDMSO , 13739-02-1
Synonym(s):
1,8-Diacetoxy-3-carboxyanthraquinone
CAS NO.:13739-02-1
Empirical Formula: C19H12O8
Molecular Weight: 368.29
MDL number: MFCD00468030
EINECS: 237-310-2
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 217-2180C |
| Boiling point: | 631.5±55.0 °C(Predicted) |
| Density | 1.491±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| pka | 3.01±0.20(Predicted) |
| form | Solid |
| color | Light Yellow to Yellow |
| Water Solubility | 240μg/L at 25℃ |
| Merck | 14,2960 |
| InChI | InChI=1S/C19H12O8/c1-8(20)26-13-5-3-4-11-15(13)18(23)16-12(17(11)22)6-10(19(24)25)7-14(16)27-9(2)21/h3-7H,1-2H3,(H,24,25) |
| InChIKey | TYNLGDBUJLVSMA-UHFFFAOYSA-N |
| SMILES | C1=C2C(C(=O)C3=C(C2=O)C=CC=C3OC(C)=O)=C(OC(C)=O)C=C1C(O)=O |
| LogP | 3.126 (est) |
| CAS DataBase Reference | 13739-02-1(CAS DataBase Reference) |
Description and Uses
Diacerein is a disease-modifying antirheumatic drug (DMARD), reported to be useful in the treatment of various inflammatory conditions, including osteoarthritis. It forms water soluble chelates with calcium and copper, acting ultimately to reduce the activity of lysosomal enzymes and decrease the formation of rheumatoid factor.
Treatment of Osteoarthritis (Prevent cartilage destruction)
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | CB8781000 |
| HS Code | 29146990 |
| Toxicity | rat,LD50,unreported,7500mg/kg (7500mg/kg),Drugs of the Future. Vol. 4, Pg. 445, 1979. |





