BD3096945
Apiin , 98% , 26544-34-3
Synonym(s):
Apigenin-7-(2-O-apiosylglucoside)
CAS NO.:26544-34-3
Empirical Formula: C26H28O14
Molecular Weight: 564.49
MDL number: MFCD00016941
EINECS: 247-780-0
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB218.40 | In Stock |
|
| 5mg | RMB432.00 | In Stock |
|
| 10mg | RMB681.60 | In Stock |
|
| 25mg | RMB1368.00 | In Stock |
|
| 50mg | RMB2179.20 | In Stock |
|
| 100mg | RMB3427.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230°C (dec.) |
| Boiling point: | 942.2±65.0 °C(Predicted) |
| Density | 1.74±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) |
| pka | 6.11±0.40(Predicted) |
| form | Solid |
| color | Pale Yellow |
| Stability: | Hygroscopic |
| Major Application | food and beverages |
| InChIKey | NTDLXWMIWOECHG-MFMSCHSJSA-N |
| SMILES | OC[C@H]1O[C@@H](Oc2cc(O)c3C(=O)C=C(Oc3c2)c4ccc(O)cc4)[C@H](O[C@@H]5OC[C@](O)(CO)[C@@H]5O)[C@@H](O)[C@@H]1O |
| LogP | 0.720 (est) |
Description and Uses
Apiin is an extract flavonoid compound from parsley which shows inhibition towards viral neuramindase. It also shows antiproliferative and apoptotic effects towards human cancer cells.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| WGK Germany | 1 |
| F | 3-10 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |







