BD3125148
(2S,3R,4S,5S)-2-(4-Nitrophenoxy)tetrahydro-2H-pyran-3,4,5-triol , 95% , 1223-07-0
Synonym(s):
4-Nitrophenyl alpha-L-arabinopyranoside;p-Nitrophenyl alpha-L-arabinopyranoside
CAS NO.:1223-07-0
Empirical Formula: C11H13NO7
Molecular Weight: 271.22
MDL number: MFCD00151486
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB556.80 | In Stock |
|
| 250mg | RMB946.40 | In Stock |
|
| 1g | RMB2555.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 205°C |
| Boiling point: | 523.2±50.0 °C(Predicted) |
| Density | 1.597±0.06 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | ethanol: water (1:1): 19.60-20.40mg/mL |
| form | powder |
| pka | 12.67±0.70(Predicted) |
| InChI | InChI=1/C11H13NO7/c13-8-5-18-11(10(15)9(8)14)19-7-3-1-6(2-4-7)12(16)17/h1-4,8-11,13-15H,5H2/t8-,9-,10+,11-/s3 |
| InChIKey | MLJYKRYCCUGBBV-COCZPBFRNA-N |
| SMILES | [C@H]1(OC[C@H](O)[C@H](O)[C@H]1O)OC1=CC=C([N+]([O-])=O)C=C1 |&1:0,3,5,7,r| |
| LogP | 0.680 (est) |
Description and Uses
4-Nitrophenyl α-L-arabinopyranoside may be used: as a 4-nitrophenyl-glycoside substrate to study the substrate activities of TlAbf51 by determining the arabinofuranosidase (Abf) activity in standard conditions. It may also be used to determine the activity of α-L-arabinofuranosidase spectrophotometrically.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280-P305+P351+P338-P304+P340-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |







