PRODUCT Properties
| Melting point: | 125-127 °C(lit.) |
| Boiling point: | 322.46°C (rough estimate) |
| Density | 1.3617 (estimate) |
| refractive index | 1.6890 (rough estimate) |
| storage temp. | 2-8°C(protect from light) |
| Colour Index | 76555 |
| pka | 7.90±0.14(Predicted) |
| color | Orange to Brown to Dark red |
| Water Solubility | <0.01 g/100 mL at 21 ºC |
| BRN | 1368435 |
| Cosmetics Ingredients Functions | HAIR DYEING |
| Cosmetic Ingredient Review (CIR) | 4-Amino-2-nitrophenol (119-34-6) |
| InChI | 1S/C6H6N2O3/c7-4-1-2-6(9)5(3-4)8(10)11/h1-3,9H,7H2 |
| InChIKey | WHODQVWERNSQEO-UHFFFAOYSA-N |
| SMILES | Nc1ccc(O)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 119-34-6(CAS DataBase Reference) |
| IARC | 3 (Vol. 16, Sup 7) 1987 |
| EPA Substance Registry System | 4-Amino-2-nitrophenol (119-34-6) |
Description and Uses
4-Amino-2-nitrophenol has been used in dyeing human hair and animal fur. The typical concentration in the “semipermanent” hair dyes was estimated to be on the order of 0.1–1.0%.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,T |
| Risk Statements | 22-36/37/38-45 |
| Safety Statements | 22-24/25-37/39-26-53-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | SJ6303000 |
| TSCA | TSCA listed |
| HS Code | 29222990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 119-34-6(Hazardous Substances Data) |



![Bis(2,4-dinitrophenyl) Oxalate [Chemiluminescence reagent for the determination of fluorescent compounds by HPLC and FIA]](https://img.chemicalbook.com/CAS/GIF/16536-30-4.gif)



