PRODUCT Properties
| Melting point: | 68-70 °C(lit.) |
| Boiling point: | 301.5±42.0 °C(Predicted) |
| Density | 1.721±0.06 g/cm3(Predicted) |
| pka | 2.06±0.44(Predicted) |
| Water Solubility | Soluble in water, 0.6 g/100 mL (18°C). |
| Sensitive | Air Sensitive |
| BRN | 1121900 |
| InChI | 1S/C7H4N2O6/c10-3-4-1-5(8(12)13)2-6(7(4)11)9(14)15/h1-3,11H |
| InChIKey | FLJXIBHYDIMYRS-UHFFFAOYSA-N |
| SMILES | Oc1c(C=O)cc(cc1[N+]([O-])=O)[N+]([O-])=O |
| CAS DataBase Reference | 2460-59-5(CAS DataBase Reference) |
| EPA Substance Registry System | Benzaldehyde, 2-hydroxy-3,5-dinitro- (2460-59-5) |
Description and Uses
It is used to produce 3-(2-hydroxy-3,5-dinitro-phenyl)-propenal with acetaldehyde. 3,5-Dinitrosalicylaldehyde has been used in the preparation of salicyldimine ligand via Schiff base condensation with allyl-substituted aniline, 3-hydroxycoumarins2, chromogenic proteinase substrates and ruthenium(II) chiral Schiff base complexes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | II |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






