BD3181245
2-Nitro-4-(trifluoromethyl)benzonitrile , 98% , 778-94-9
CAS NO.:778-94-9
Empirical Formula: C8H3F3N2O2
Molecular Weight: 216.12
MDL number: MFCD00014684
EINECS: 212-298-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB28.00 | In Stock |
|
| 25g | RMB80.80 | In Stock |
|
| 100g | RMB178.40 | In Stock |
|
| 500g | RMB733.60 | In Stock |
|
| 1000g | RMB1336.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 44-47 °C(lit.) |
| Boiling point: | 156-158 °C18 mm Hg(lit.) |
| Density | 1.5604 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| color | Low-melting |
| BRN | 1882259 |
| InChI | InChI=1S/C8H3F3N2O2/c9-8(10,11)6-2-1-5(4-12)7(3-6)13(14)15/h1-3H |
| InChIKey | BQCWLXXZTCLGSZ-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(C(F)(F)F)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 778-94-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Cyano-3-nitrobenzotrifluoride(778-94-9) |
Description and Uses
2-Nitro-4-(trifluoromethyl)benzonitrile was used in the preparation of 2-nitro-4-(trifluoromethyl)benzaldehyde.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,T,Xn |
| Risk Statements | 36/37/38-20/21/22-36/38 |
| Safety Statements | 26-36-36/37/39-36/37 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







