BD3192848
(4-Fluorophenyl)hydrazine , 95% , 371-14-2
CAS NO.:371-14-2
Empirical Formula: C6H7FN2
Molecular Weight: 126.13
MDL number: MFCD00041262
EINECS: 206-732-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB220.00 | In Stock |
|
| 5g | RMB760.00 | In Stock |
|
| 25g | RMB2582.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 36.8 °C |
| Boiling point: | 227℃ |
| Density | 1.257 |
| Flash point: | 91℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| pka | 5.24±0.20(Predicted) |
| Appearance | Yellow to brown Solid |
| InChI | InChI=1S/C6H7FN2/c7-5-1-3-6(9-8)4-2-5/h1-4,9H,8H2 |
| InChIKey | ZXBMIRYQUFQQNX-UHFFFAOYSA-N |
| SMILES | N(C1=CC=C(F)C=C1)N |
Description and Uses
4-Fluorophenylhydrazine is a versatile reactant used in various syntheses such as domino synthesis of indoles by zinc-promoted hydrohydrazination of terminal alkynes.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS05 |
| Signal word | Danger |
| Hazard statements | H302-H318-H315-H335 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P302+P352-P321-P332+P313-P362-P280-P305+P351+P338-P310 |




![ETHYL 2-CHLORO-2-[2-(3-CHLORO-4-FLUOROPHENYL)-HYDRAZONO]ACETATE](https://img.chemicalbook.com/CAS/GIF/81321-37-1.gif)


