BD3204745
Di-tert-butylmaleate , 97% , 18305-60-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB336.00 | In Stock |
|
| 1g | RMB845.60 | In Stock |
|
| 5g | RMB2544.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64-65 °C |
| Boiling point: | 273.2±13.0 °C(Predicted) |
| Density | 1.004±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform, Methanol (Slightly) |
| form | Solid |
| color | Off-White |
| InChI | InChI=1S/C12H20O4/c1-11(2,3)15-9(13)7-8-10(14)16-12(4,5)6/h7-8H,1-6H3/b8-7- |
| InChIKey | MSVGHYYKWDQHFV-FPLPWBNLSA-N |
| SMILES | C(OC(C)(C)C)(=O)/C=C\C(OC(C)(C)C)=O |
Description and Uses
Di-tert-butyl Maleate is used as a reactant in the synthesis of J-104,118, a novel, potent inhibitor of squalene synthase.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P305+P351+P338 |
