BD3228848
4,5,6,7-Tetrahydro-1H-indole , 98% , 13618-91-2
Synonym(s):
2,3-Tetramethylenepyrrole;Cyclohex[b]pyrrole;NSC 122455
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB240.00 | In Stock |
|
| 250mg | RMB577.60 | In Stock |
|
| 1g | RMB1200.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 53-57 °C(lit.) |
| Boiling point: | 64 °C(Press: 0.1 Torr) |
| Density | 1.057±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | solid |
| pka | 18.03±0.20(Predicted) |
| Appearance | Brown to pink Solid |
| BRN | 108853 |
| InChI | InChI=1S/C8H11N/c1-2-4-8-7(3-1)5-6-9-8/h5-6,9H,1-4H2 |
| InChIKey | KQBVVLOYXDVATK-UHFFFAOYSA-N |
| SMILES | N1C2=C(CCCC2)C=C1 |
Description and Uses
4,5,6,7-Tetrahydro-1H-indole is used in preparation of chiral tetraaryl-substituted Methane. Also, used in preparation of 4-substituted Phenylamidine derivatives used for controlling phytopathogenic microorganisms.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| F | 1-10 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






