BD3251845
Eriodictyol , 99+% , 552-58-9
Synonym(s):
(S)-3′,4′,5,7-Tetrahydroxyflavanone;3′,4′,5,7-Tetrahydroxyflavanone;3·,4·,5,7-Tetrahydroxyflavanone;Eriodictiol;Huazhongilexone
CAS NO.:552-58-9
Empirical Formula: C15H12O6
Molecular Weight: 288.25
MDL number: MFCD00135890
EINECS: 209-016-4
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB559.20 | In Stock |
|
| 50mg | RMB893.60 | In Stock |
|
| 100mg | RMB1428.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 270°C |
| Boiling point: | 625.2±55.0 °C(Predicted) |
| Density | 1.586±0.06 g/cm3(Predicted) |
| FEMA | 4715 | 2-(3,4-DIHYDROXYPHENYL)-5,7-DIHYDROXY-4-CHROMANON |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Very Slightly) |
| form | Solid |
| pka | 7.49±0.40(Predicted) |
| color | White to Pale Beige |
| Water Solubility | 70mg/L(20 ºC) |
| JECFA Number | 2172 |
| BRN | 5104930 |
| Stability: | Hygroscopic |
| InChI | 1S/C15H12O6/c16-8-4-11(19)15-12(20)6-13(21-14(15)5-8)7-1-2-9(17)10(18)3-7/h1-5,13,16-19H,6H2/t13-/m0/s1 |
| InChIKey | SBHXYTNGIZCORC-ZDUSSCGKSA-N |
| SMILES | Oc1cc(O)c2C(=O)C[C@H](Oc2c1)c3ccc(O)c(O)c3 |
| CAS DataBase Reference | 552-58-9(CAS DataBase Reference) |
Description and Uses
Eriodictyol is used in biological studies as natural compounds as sources of new bifunctional scaffolds targeting cholinesterases and beta amyloid aggregation. Eriodictyl is extracted from Yerba santa, an herb. The leaf is used to make medicine.Yerba santa is used for respiratory conditions including coughs, colds, tuberculosis, asthma, and chronic bronchitis. It is also used for fever and dry mouth. Some people use it to relieve muscle spasms, to loosen phlegm, and as a tonic.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |





