BD3277045
5-Oxotetrahydrofuran-2-carboxylicacid , 95% , 4344-84-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB29.60 | In Stock |
|
| 1g | RMB55.20 | In Stock |
|
| 5g | RMB156.00 | In Stock |
|
| 10g | RMB274.40 | In Stock |
|
| 25g | RMB552.80 | In Stock |
|
| 100g | RMB1955.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 48-50 °C |
| Boiling point: | 116-118 °C(Press: 1.5 Torr) |
| Density | 1.469±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Water (Sparingly) |
| form | Solid |
| pka | 3.11±0.20(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C5H6O4/c6-4-2-1-3(9-4)5(7)8/h3H,1-2H2,(H,7,8) |
| InChIKey | QVADRSWDTZDDGR-UHFFFAOYSA-N |
| SMILES | O1C(=O)CCC1C(O)=O |
Description and Uses
Carboxybutyrolactone is a structural analog of (±)-Paraconic Acid (P191200) and is used as a reagent in the synthesis of methylenecarboxybutyrolactones which have antibacterial activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
