BD3352545
4-Amino-N-(6-chloropyridazin-3-yl)benzenesulfonamide , 95% , 80-32-0
Synonym(s):
N1-(6-Chloro-3-pyridazinyl)sulfanilamide;4-Amino-N-(6-chloro-3-pyridazinyl)benzenesulfonamide;Sulfachloropyridazine
CAS NO.：80-32-0
Empirical Formula: C10H9ClN4O2S
Molecular Weight: 284.72
MDL number: MFCD00057371
EINECS: 201-269-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB30.40 | In Stock |
|
| 5g | RMB118.40 | In Stock |
|
| 25g | RMB398.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 186-187℃ |
| Boiling point: | 559.7±60.0 °C(Predicted) |
| Density | 1.588 |
| refractive index | 1.6300 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | 0.5 M NaOH: soluble50mg/mL |
| pka | pKa 6.10 (Uncertain) |
| form | powder |
| color | off-white to light yellow |
| BRN | 261558 |
| Major Application | clinical testing |
| InChI | 1S/C10H9ClN4O2S/c11-9-5-6-10(14-13-9)15-18(16,17)8-3-1-7(12)2-4-8/h1-6H,12H2,(H,14,15) |
| InChIKey | XOXHILFPRYWFOD-UHFFFAOYSA-N |
| SMILES | Nc1ccc(cc1)S(=O)(=O)Nc2ccc(Cl)nn2 |
| EPA Substance Registry System | Benzenesulfonamide, 4-amino-N-(6-chloro-3-pyridazinyl)- (80-32-0) |
Description and Uses
Sulfachloropyridazine is an antibacterial compound.This compound is a contaminant of emerging concern (CECs).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P280 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 43 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2935909550 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |
