BD3352751
N,N-Bis((S)-1-phenylethyl)dibenzo[d,f][1,3,2]dioxaphosphepin-6-amine , 98% , 376355-58-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB207.20 | In Stock |
|
| 250mg | RMB348.00 | In Stock |
|
| 1g | RMB934.40 | In Stock |
|
| 5g | RMB3944.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 99-102 °C |
| Boiling point: | 578.4±53.0 °C(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Powder |
| pka | -0.31±0.20(Predicted) |
| color | white |
| optical activity | [α]/D -250±10°, c = 1 in toluene |
| Sensitive | moisture sensitive |
| InChI | 1S/C28H26NO2P/c1-21(23-13-5-3-6-14-23)29(22(2)24-15-7-4-8-16-24)32-30-27-19-11-9-17-25(27)26-18-10-12-20-28(26)31-32/h3-22H,1-2H3 |
| InChIKey | JISGHECLGYELKD-UHFFFAOYSA-N |
| SMILES | C[C@H](N([C@@H](C)c1ccccc1)P2Oc3ccccc3-c4ccccc4O2)c5ccccc5 |
Description and Uses
N,N-Bis-((S)-1-phenylethyl)dibenzo[d,f][1,3,2]dioxaphosphepin-6-amine can be used:
- In the iridium catalyzed allylic arylation.
- To prepare a copper complex (Cu2X2L3), which is used to detect the transmetalation intermediates in asymmetric addition reactions using ZnEt2.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |

![N,N-Bis((S)-1-phenylethyl)dibenzo[d,f][1,3,2]dioxaphosphepin-6-amine](https://img.chemicalbook.com/CAS/GIF/376355-58-7.gif)
![(S)-(+)-(3,5-Dioxa-4-phospha-cyclohepta[2,1-a;3,4-a']dinaphthalen-4-yl)bis[(1S)-1-phenylethyl]amine.](https://img.chemicalbook.com/CAS/GIF/380230-02-4.gif)