BD3354045
2,3,4,5,6-Pentafluorobenzaldehyde , 97% , 653-37-2
CAS NO.:653-37-2
Empirical Formula: C7HF5O
Molecular Weight: 196.07
MDL number: MFCD00003303
EINECS: 211-502-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB81.60 | In Stock |
|
| 10g | RMB157.60 | In Stock |
|
| 25g | RMB337.60 | In Stock |
|
| 100g | RMB1320.80 | In Stock |
|
| 500g | RMB6128.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 24-28 °C(lit.) |
| Boiling point: | 164-166 °C(lit.) |
| Density | 1.588 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 172 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | Liquid After Melting |
| Specific Gravity | 1.588 |
| color | Clear yellow |
| Water Solubility | Sparingly Soluble in water (0.027 g/L at 25°C). |
| Sensitive | Air Sensitive |
| BRN | 1876550 |
| InChI | InChI=1S/C7HF5O/c8-3-2(1-13)4(9)6(11)7(12)5(3)10/h1H |
| InChIKey | QJXCFMJTJYCLFG-UHFFFAOYSA-N |
| SMILES | C(=O)C1=C(F)C(F)=C(F)C(F)=C1F |
| CAS DataBase Reference | 653-37-2(CAS DataBase Reference) |
Description and Uses
Pentafluorobenzaldehyde was used as derivatization reagent in a study to develop a sensitive method for the determination of primary amines in sewage sludge by headspace solid-phase micro extraction and gas chromatography-tandem mass spectrometry. It was used in the synthesis of novel, high molecular weight fluorinated aromatic polymers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H332-H335 |
| Precautionary statements | P261-P264-P271-P302+P352-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,F,Xi |
| Risk Statements | 20/22-36/37/38-20 |
| Safety Statements | 26-37/39 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | CU7542000 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29130000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





![Pentafluorophenyldimethylchlorosilane [Pentafluorophenyldimethylsilylating Agent]](https://img.chemicalbook.com/CAS/GIF/20082-71-7.gif)

