BD3357945
(2,8-Bis(trifluoromethyl)quinolin-4-yl)(pyridin-2-yl)methanone , 97% , 35853-55-5
CAS NO.：35853-55-5
Empirical Formula: C17H8F6N2O
Molecular Weight: 370.25
MDL number: MFCD05863551
EINECS: 252-763-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB80.00 | In Stock |
|
| 250mg | RMB120.00 | In Stock |
|
| 1g | RMB298.40 | In Stock |
|
| 5g | RMB1122.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 427.8±45.0 °C(Predicted) |
| Density | 1.451 |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 1.38±0.10(Predicted) |
| form | solid |
| InChI | 1S/C17H8F6N2O/c18-16(19,20)11-5-3-4-9-10(15(26)12-6-1-2-7-24-12)8-13(17(21,22)23)25-14(9)11/h1-8H |
| InChIKey | GZTUXOWPGYDWNO-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(C(=O)c2ccccn2)c3cccc(c3n1)C(F)(F)F |
Description and Uses
[2,8-Bis(trifluoromethyl)-4-quinolinyl]-2-pyridinylmethanone is an intermediate in the synthesis of Mefloquine Hydrochloride (M207052) which is a labelled quinoline methanol antimalarial agent.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H413 |
| Precautionary statements | P301+P310 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HS Code | 2933499090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 4 |
