BD3371948
tert-Butyl4-(pyrimidin-2-yl)piperazine-1-carboxylate , 97% , 780705-64-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB160.00 | In Stock |
|
| 5g | RMB560.00 | In Stock |
|
| 25g | RMB1957.60 | In Stock |
|
| 100g | RMB6457.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 405.8±55.0 °C(Predicted) |
| Density | 1.167±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light |
| pka | 4.87±0.33(Predicted) |
| Appearance | Light yellow to light brown Solid |
| InChI | InChI=1S/C13H20N4O2/c1-13(2,3)19-12(18)17-9-7-16(8-10-17)11-14-5-4-6-15-11/h4-6H,7-10H2,1-3H3 |
| InChIKey | YEEDHQBGXCVRDP-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCN(C2=NC=CC=N2)CC1 |
Description and Uses
tert-Butyl 4-(2-Pyrimidinyl)-1-piperazinecarboxylate-D8 is an intermediate used in the synthesis of 2-(1-Piperazinyl)pyrimidine-d8 (P481302), which is a labelled 2-(1-Piperazinyl)pyrimidine, the major metabolite of Tandospirone (T006430).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
