A2770812
2-chloropyrimidin-5-ol , 97% , 4983-28-2
CAS NO.：4983-28-2
Empirical Formula: C4H3ClN2O
Molecular Weight: 130.53
MDL number: MFCD09743796
EINECS: 826-504-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB61.60 | In Stock |
|
| 5g | RMB180.80 | In Stock |
|
| 10g | RMB303.20 | In Stock |
|
| 25g | RMB665.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 195-196 °C |
| Boiling point: | 328.1±15.0 °C(Predicted) |
| Density | 1.513±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 6.17±0.23(Predicted) |
| Appearance | Off-white to light brown Solid |
| InChI | InChI=1S/C4H3ClN2O/c5-4-6-1-3(8)2-7-4/h1-2,8H |
| InChIKey | BOGPIHXNWPTGNH-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(O)C=N1 |
| CAS DataBase Reference | 4983-28-2(CAS DataBase Reference) |
Description and Uses
2-Chloro-5-hydroxypyrimidine is an intermediate used to synthesize tandospirone derivatives with anxiolytic activities.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P280 |
| HS Code | 29335990 |
