![4,4,5,5-Tetramethyl-2-[3-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane](https://img.chemicalbook.com/CAS/GIF/262376-31-8.gif)
BD3387253
4,4,5,5-Tetramethyl-2-[3-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane , 98+% , 262376-31-8
CAS NO.：262376-31-8
Empirical Formula: C13H16BF3O3
Molecular Weight: 288.07
MDL number: MFCD05863919
EINECS: 675-105-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB61.60 | In Stock |
|
| 5g | RMB249.60 | In Stock |
|
| 25g | RMB1228.80 | In Stock |
|
| 100g | RMB3444.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 299.7±40.0 °C(Predicted) |
| Density | 1.18±0.1 g/cm3(Predicted) |
| refractive index | 1.4440 to 1.4480 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| InChI | 1S/C13H16BF3O3/c1-11(2)12(3,4)20-14(19-11)9-6-5-7-10(8-9)18-13(15,16)17/h5-8H,1-4H3 |
| InChIKey | BUSBFOTXIPZTDH-UHFFFAOYSA-N |
| SMILES | B2(OC(C(O2)(C)C)(C)C)c1cc(ccc1)OC(F)(F)F |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317 |
| Precautionary statements | P280-P301+P312+P330-P302+P352 |
| Risk Statements | 43 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |
