BD3390451
5,10,15,20-Tetrakis(4-methylphenyl)-21H,23H-porphine , 98% , 14527-51-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB80.00 | In Stock |
|
| 1g | RMB221.60 | In Stock |
|
| 5g | RMB776.80 | In Stock |
|
| 25g | RMB2665.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300℃ |
| Density | 1?+-.0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Solid |
| color | Pale purple to purple |
| λmax | 648nm(Toluene)(lit.) |
| InChIKey | SFQNUQLWBBZIOZ-PJEPRTEXSA-N |
| SMILES | C1(C2=CC=C(C)C=C2)=C2N=C(C(C3=CC=C(C)C=C3)=C3NC(=C(C4=CC=C(C)C=C4)C4=NC(=C(C5=CC=C(C)C=C5)C5NC1=CC=5)C=C4)C=C3)C=C2 |c:20,t:8,23,35| |
Description and Uses
meso-Tetra (4-Methylphenyl) Porphine is a synthetic tetra-tolylated porphyrin used for research.
